CAS 35153-16-3
:(Z)-10-Tetradecenyl acetate
Description:
(Z)-10-Tetradecenyl acetate is an organic compound classified as a fatty acid ester. It features a long hydrocarbon chain, specifically a tetradecene backbone, which contributes to its hydrophobic characteristics. The "Z" configuration indicates that the double bond in the carbon chain has a specific geometric arrangement, where the highest priority substituents on either side of the double bond are on the same side, leading to a cis configuration. This compound is typically colorless to pale yellow and has a characteristic fruity odor, making it of interest in the fragrance and flavor industry. It is soluble in organic solvents but has limited solubility in water due to its long hydrophobic chain. (Z)-10-Tetradecenyl acetate is also known for its role in pheromone production in certain insects, which can be significant in ecological and agricultural contexts. Its chemical structure allows for various applications, including use as a flavoring agent, in perfumes, and in research related to insect behavior.
Formula:C16H30O2
InChI:InChI=1S/C16H30O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16(2)17/h5-6H,3-4,7-15H2,1-2H3/b6-5-
InChI key:InChIKey=LAXUVNVWTBEWKE-WAYWQWQTSA-N
SMILES:C(CCCCC/C=C\CCC)CCCOC(C)=O
Synonyms:- (E)-10-Tetradecenyl acetate
- (Z)-10-Tetradecenyl acetate
- 10-Tetradecen-1-ol, 1-acetate, (10Z)-
- 10-Tetradecen-1-ol, acetate, (10Z)-
- 10-Tetradecen-1-ol, acetate, (Z)-
- 10-tetradecen-1-ol, acetate, (10E)-
- cis-10-Tetradecen-1-ol acetate
- cis-10-Tetradecenyl acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(Z)-10-Tetradecenyl Acetate
CAS:Controlled ProductFormula:C16H30O2Color and Shape:NeatMolecular weight:291.303
