CAS 3516-87-8

ethyl (pentafluorobenzoyl)acetate

Description:

Ethyl (pentafluorobenzoyl)acetate is an organic compound characterized by its unique structure, which includes an ethyl ester group and a pentafluorobenzoyl moiety. This compound is notable for its high degree of fluorination, which imparts distinct chemical properties such as increased lipophilicity and thermal stability. The presence of multiple fluorine atoms enhances its reactivity and can influence its behavior in various chemical reactions, making it useful in synthetic organic chemistry. Ethyl (pentafluorobenzoyl)acetate is typically a colorless to pale yellow liquid with a characteristic odor. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. This compound is often utilized in the synthesis of more complex fluorinated compounds and can serve as a reagent in various chemical transformations. Safety precautions should be observed when handling this substance, as it may pose health risks if inhaled or ingested. Proper storage and disposal methods are essential to mitigate any environmental impact.

Formula: C₁₁H₇F₅O₃

InChI: InChI=1/C11H7F5O3/c1-2-5(18)19-3-4(17)6-7(12)9(14)11(16)10(15)8(6)13/h2-3H2,1H3

SMILES: CCC(=O)OCC(=O)c1c(c(c(c(c1F)F)F)F)F

Synonyms:

• Ethyl 3-Oxo-3-(Pentafluorophenyl)Propanoate
• 2-Oxo-2-(Pentafluorophenyl)Ethyl Propanoate

Ethyl (pentafluorobenzoyl)acetate

CAS: 3516-87-8

Formula: C₁₁H₇F₅O₃

Purity: 98%

Color and Shape: Liquid

Molecular weight: 282.1635

Ref: IN-DA00C0IM

Ethyl 3-oxo-3-(pentafluorophenyl)propanoate

CAS: 3516-87-8

Ethyl 3-oxo-3-(pentafluorophenyl)propanoate

Purity: 97%

Color and Shape: Colourless Liquid

Molecular weight: 282.16g/mol

Ref: 54-PC5767

Ethyl (Pentafluorobenzoyl)acetate

Controlled Product

CAS: 3516-87-8

Applications Ethyl (pentafluorobenzoyl)acetate (cas# 3516-87-8) is a useful research chemical.

Formula: C₁₁H₇O₃F₅

Color and Shape: Colourless

Molecular weight: 282.16

Ref: TR-E818018