CAS 35166-41-7

5-Methyl-3-isoxazoleacetonitrile

Description:

5-Methyl-3-isoxazoleacetonitrile is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This substance features a methyl group at the 5-position and an acetonitrile functional group, contributing to its unique reactivity and properties. It is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. The compound is known for its potential applications in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure allows for various chemical reactions, making it a versatile intermediate in the synthesis of more complex molecules. Additionally, 5-Methyl-3-isoxazoleacetonitrile may exhibit specific biological activities, although detailed studies on its pharmacological properties are necessary to fully understand its potential uses. As with many chemical substances, proper handling and safety precautions are essential due to its potential toxicity and reactivity.

Formula: C₆H₆N₂O

InChI: InChI=1S/C6H6N2O/c1-5-4-6(2-3-7)8-9-5/h4H,2H2,1H3

InChI key: InChIKey=FMCBKOOPDBRCGZ-UHFFFAOYSA-N

SMILES: C(C#N)C=1C=C(C)ON1

Synonyms:

• 2-(5-Methyl-1,2-oxazol-3-yl)acetonitrile
• (5-Methylisoxazol-3-yl)acetonitrile
• 2-(5-Methylisoxazol-3-yl)acetonitrile
• 3-Isoxazoleacetonitrile, 5-methyl-
• 5-Methyl-3-isoxazoleacetonitrile

2-(5-Methylisoxazol-3-yl)acetonitrile

CAS: 35166-41-7

Formula: C₆H₆N₂O

Purity: 95%

Color and Shape: Liquid

Molecular weight: 122.1246

Ref: IN-DA00C8GV

-2(5-Methylisoxazol-3-Yl)Acetonitrile

CAS: 35166-41-7

-2(5-Methylisoxazol-3-Yl)Acetonitrile is a heterocyclic compound that is used as a catalyst in cross-coupling reactions. It can be utilised for the synthesis of aromatic heterocycles and tosylate derivatives. -2(5-Methylisoxazol-3-Yl)Acetonitrile is an analogue of 2,5-dimethylisoxazole, and it can be used as a synthetic intermediate for the synthesis of various pharmaceuticals.

Formula: C₆H₆N₂O

Purity: Min. 95%

Molecular weight: 122.12 g/mol

Ref: 3D-KBA16641