CymitQuimica logo

CAS 35170-94-6

:

1,8-Naphthyridine,4-chloro-

Description:
1,8-Naphthyridine, 4-chloro- is a heterocyclic organic compound characterized by a fused bicyclic structure that contains both a pyridine and a naphthalene moiety. The presence of a chlorine atom at the 4-position of the naphthyridine ring significantly influences its chemical properties, including its reactivity and potential applications. This compound typically exhibits basic properties due to the nitrogen atom in the pyridine ring, which can participate in protonation and coordination with metal ions. It is often utilized in medicinal chemistry and material science due to its ability to act as a building block for various pharmaceuticals and agrochemicals. Additionally, 1,8-naphthyridine derivatives are known for their biological activities, including antimicrobial and antitumor properties. The compound's solubility, stability, and reactivity can vary based on the presence of substituents and the specific conditions under which it is handled. Overall, 1,8-Naphthyridine, 4-chloro- is a versatile compound with significant implications in both research and industrial applications.
Formula:C8H5ClN2
InChI:InChI=1S/C8H5ClN2/c9-7-3-5-11-8-6(7)2-1-4-10-8/h1-5H
InChI key:SIADAGFXEHBPGG-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=CN=C2N=C1)Cl
Synonyms:
  • 4-Chloro-1,8-naphthyridine
Found 4 products.