CAS 35181-24-9

2-(4-bromophenyl)-6-methoxyquinoline-4-carboxylic acid

Description:

2-(4-bromophenyl)-6-methoxyquinoline-4-carboxylic acid is a chemical compound characterized by its quinoline structure, which features a carboxylic acid functional group and a methoxy group. The presence of the 4-bromophenyl substituent enhances its aromatic properties and may influence its reactivity and biological activity. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to the hydrophobic nature of the quinoline ring. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as quinoline derivatives are known for their diverse biological activities, including antimicrobial and anticancer properties. The carboxylic acid group can participate in hydrogen bonding and may affect the compound's interaction with biological targets. Additionally, the bromine atom can serve as a site for further chemical modifications, making this compound a versatile intermediate in synthetic organic chemistry. Overall, its unique structural features contribute to its potential utility in various chemical and biological applications.

Formula: C₁₇H₁₂BrNO₃

InChI: InChI=1/C17H12BrNO3/c1-22-12-6-7-15-13(8-12)14(17(20)21)9-16(19-15)10-2-4-11(18)5-3-10/h2-9H,1H3,(H,20,21)/p-1

Synonyms:

• 4-quinolinecarboxylic acid, 2-(4-bromophenyl)-6-methoxy-
• 2-(4-Bromophenyl)-6-methoxyquinoline-4-carboxylic acid
• 2-(4-BROMO-PHENYL)-6-METHOXY-QUINOLINE-4-CARBOXYLIC ACID
• 2-(4-bromophenyl)-6-methoxy-4-quinolinecarboxylic acid

2-(4-Bromophenyl)-6-methoxyquinoline-4-carboxylic acid

CAS: 35181-24-9

Versatile small molecule scaffold

Formula: C₁₇H₁₂BrNO₃

Purity: Min. 95%

Molecular weight: 358.2 g/mol

Ref: 3D-KBA18124