CAS 35190-68-2

bis(p-(mewthoxycarbonyl)phenyl)disulfide

Description:

Bis(p-(methoxycarbonyl)phenyl)disulfide, identified by its CAS number 35190-68-2, is an organic compound characterized by the presence of two p-(methoxycarbonyl)phenyl groups linked by a disulfide (-S-S-) bond. This compound typically exhibits a white to light yellow crystalline appearance. The methoxycarbonyl groups contribute to its solubility in organic solvents and influence its reactivity, particularly in nucleophilic substitution reactions. The disulfide linkage imparts unique properties, such as the ability to undergo oxidation and reduction, which can be exploited in various chemical applications, including polymer chemistry and materials science. Additionally, the compound may exhibit interesting thermal and photochemical stability, making it suitable for use in specific industrial processes. Its structural features suggest potential applications in the synthesis of more complex molecules, as well as in the development of functional materials. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.

Formula: C₁₆H₁₄O₄S₂

InChI: InChI=1/C16H14O4S2/c1-19-15(17)11-3-7-13(8-4-11)21-22-14-9-5-12(6-10-14)16(18)20-2/h3-10H,1-2H3

SMILES: COC(=O)c1ccc(cc1)SSc1ccc(cc1)C(=O)OC

Synonyms:

• Dimethyl 4,4'-Disulfanediyldibenzoate

Dimethyl 4,4'-disulfanediyldibenzoate

CAS: 35190-68-2

Formula: C₁₆H₁₄O₄S₂

Purity: %

Color and Shape: Solid

Molecular weight: 334.4100

Ref: IN-DA007FJ4

4,4'-Dithiobisbenzoic Acid Dimethyl Ester

Controlled Product

CAS: 35190-68-2

Applications 4,4'-Dithiobisbenzoic Acid Dimethyl Ester (cas# 35190-68-2) is a compound useful in organic synthesis.

Formula: C₁₆H₁₄O₄S₂

Color and Shape: Neat

Molecular weight: 334.41

Ref: TR-D494210