CAS 35193-18-1
:lys-tyr-lys acetate
Description:
Lys-tyr-lys acetate, also known as a peptide, is a synthetic compound composed of the amino acids lysine (Lys) and tyrosine (Tyr) linked together in a specific sequence. This compound typically exhibits characteristics common to peptides, such as solubility in water and the ability to form hydrogen bonds due to the presence of amino and carboxyl functional groups. The acetate component indicates that the compound is in its acetate salt form, which can enhance its solubility and stability. Peptides like lys-tyr-lys acetate may have biological activity, potentially influencing various physiological processes, including hormone regulation and neurotransmission. The specific sequence of amino acids can affect its interaction with biological receptors and enzymes. Additionally, the compound may be used in research and pharmaceutical applications, particularly in studies related to peptide synthesis and drug development. As with many peptides, stability and activity can be influenced by factors such as pH, temperature, and the presence of other ions or molecules in the environment.
Formula:C23H39N5O7
InChI:InChI=1/C21H35N5O5.C2H4O2/c22-11-3-1-5-16(24)19(28)26-18(13-14-7-9-15(27)10-8-14)20(29)25-17(21(30)31)6-2-4-12-23;1-2(3)4/h7-10,16-18,27H,1-6,11-13,22-24H2,(H,25,29)(H,26,28)(H,30,31);1H3,(H,3,4)
SMILES:C(CCN)CC(C(=NC(Cc1ccc(cc1)O)C(=NC(CCCCN)C(=O)O)O)O)N.CC(=O)O
Synonyms:- H-Lys-Tyr-Lys-OH
- Lysyltyrosyllysine
- L-lysyl-L-tyrosyl-L-lysine
- Lysyltyrosyllysine Acetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
H-Lys-Tyr-Lys-OH
CAS:The tripeptide KYK is able to nick supercoiled or relaxed DNAs at apurinic/apyrimidinic sites.Formula:C21H35N5O5Purity:98.9%Color and Shape:White PowderMolecular weight:437.54H-Lys-Tyr-Lys-OH acetate salt
CAS:H-Lys-Tyr-Lys-OH acetate salt is a cyclic peptide that is glycosylated with an acetate residue. This compound has been shown to have anti-inflammatory properties, as it inhibits the production of fatty acids and covalent adducts induced by light exposure or dietary factors. H-Lys-Tyr-Lys-OH acetate salt also has been shown to inhibit the uptake of hydrogen ions at neutral pH, and also functions as a cationic surfactant.Formula:C21H35N5O5Purity:Min. 95%Molecular weight:437.53 g/molLysyl-tyrosyl-lysine
CAS:Lysyl-tyrosyl-lysine is a bioactive chemical.Formula:C21H35N5O5Purity:98%Color and Shape:SolidMolecular weight:437.54




