
CAS 35194-30-0
:9-Decen-2-one
Description:
9-Decen-2-one is an unsaturated ketone characterized by a long carbon chain and a double bond located at the ninth carbon from one end of the molecule. Its molecular formula is C10H18O, indicating it contains ten carbon atoms, eighteen hydrogen atoms, and one oxygen atom. The presence of the carbonyl group (C=O) defines its ketone functionality, while the double bond contributes to its unsaturation. This compound typically exhibits a distinctive odor, which can be described as floral or fruity, making it of interest in the fragrance and flavor industries. 9-Decen-2-one is also known for its potential applications in organic synthesis and as a building block in the production of various chemical compounds. It is important to handle this substance with care, as it may pose health risks if inhaled or ingested. Additionally, its reactivity due to the double bond allows it to participate in various chemical reactions, including hydrogenation and oxidation, further expanding its utility in chemical processes.
Formula:C10H18O
InChI:InChI=1S/C10H18O/c1-3-4-5-6-7-8-9-10(2)11/h3H,1,4-9H2,2H3
InChI key:InChIKey=DZECLZDTSQJBSU-UHFFFAOYSA-N
SMILES:C(CCCC=C)CCC(C)=O
Synonyms:- 9-Decen-2-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
9-Decen-2-one
CAS:<p>9-Decen-2-one is an aliphatic ketone.</p>Formula:C10H18OColor and Shape:SolidMolecular weight:154.25Dec-9-en-2-one
CAS:<p>Dec-9-en-2-one is a molecule with two stereoisomers, D and L. The D stereoisomer is the most prevalent form found in nature. It is produced by enzymatic or chemical reactions that occur in the stomach or small intestine, or by the methylation of other compounds. The major use of the D stereoisomer is as a treatment for various types of cancer. Dec-9-en-2-one has been shown to inhibit tumor cells by interfering with their ability to divide and replicate DNA. This inhibition can be accomplished by inhibiting either purine synthesis or DNA topoisomerase II (topo II) activity, which are both essential for DNA replication. Dec-9-en-2-one also inhibits lipid peroxidation and has been shown to activate the antioxidant response element (ARE) pathway, which may contribute to its anti cancer effects.</p>Formula:C10H18OPurity:Min. 95%Molecular weight:154.25 g/mol



