CAS 35199-18-9

4-(chloromethyl)-2-(4-methylphenyl)-1,3-thiazole

Description:

4-(Chloromethyl)-2-(4-methylphenyl)-1,3-thiazole is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The presence of a chloromethyl group (-CH2Cl) at the 4-position and a para-methylphenyl group at the 2-position contributes to its unique chemical properties and reactivity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis due to the presence of reactive functional groups. The thiazole moiety is known for its biological activity, making derivatives of this compound of interest in medicinal chemistry. Safety data should be consulted, as the chloromethyl group can be reactive and may pose health risks. Overall, 4-(chloromethyl)-2-(4-methylphenyl)-1,3-thiazole is a compound of interest for further research and development in various chemical applications.

Formula: C₁₁H₁₀ClNS

InChI: InChI=1/C11H10ClNS/c1-8-2-4-9(5-3-8)11-13-10(6-12)7-14-11/h2-5,7H,6H2,1H3

SMILES: Cc1ccc(cc1)c1nc(CCl)cs1

Synonyms:

• Thiazole, 4-(Chloromethyl)-2-(4-Methylphenyl)-

4-(chloromethyl)-2-(4-methylphenyl)-1,3-thiazole

CAS: 35199-18-9

Formula: C₁₁H₁₀ClNS

Purity: 90.0%

Molecular weight: 223.72

Ref: 10-F307670