CAS 351994-94-0
:1,3-Benzenedicarboxamide, N,N'-bis(2-mercaptoethyl)-
Description:
1,3-Benzenedicarboxamide, N,N'-bis(2-mercaptoethyl)-, also known by its CAS number 351994-94-0, is a chemical compound characterized by its structure, which includes a benzene ring with two carboxamide groups and two mercaptoethyl substituents. This compound typically exhibits properties associated with both amides and thiols, such as potential solubility in polar solvents and the ability to form hydrogen bonds due to the presence of the amide functional groups. The mercaptoethyl groups contribute to its reactivity, particularly in thiol-related chemistry, allowing for potential applications in various fields, including materials science and biochemistry. The presence of multiple functional groups suggests that it may participate in diverse chemical reactions, including nucleophilic substitutions and redox reactions. Additionally, the compound may exhibit biological activity, making it of interest for pharmaceutical research. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate risks associated with its use.
Formula:C12H16N2O2S2
InChI:InChI=1S/C12H16N2O2S2/c15-11(13-4-6-17)9-2-1-3-10(8-9)12(16)14-5-7-18/h1-3,8,17-18H,4-7H2,(H,13,15)(H,14,16)
InChI key:InChIKey=JUTBAVRYDAKVGQ-UHFFFAOYSA-N
SMILES:C(NCCS)(=O)C1=CC(C(NCCS)=O)=CC=C1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Emeramide
CAS:Emeramide (BDTH2) is a thiol-redox antioxidant. It is also a heavy metal chelator.Formula:C12H16N2O2S2Purity:98.73%Color and Shape:SolidMolecular weight:284.41,3-(N-Mercaptoethylcarboxamide)benzene, 99% BDET
CAS:1,3-(N-Mercaptoethylcarboxamide)benzene, 99% BDET
Formula:C12H16N2O2S2Purity:99%Color and Shape:white solidMolecular weight:284.39Emeramide
CAS:Controlled ProductStability Hygroscopic
Applications is a novel lipid-soluble, thiol-redox antioxidant and heavy metal chelator.Formula:C12H16N2O2S2Color and Shape:NeatMolecular weight:284.4N,N'-Bis(2-mercaptoethyl)isophthalamide
CAS:N,N'-Bis(2-mercaptoethyl)isophthalamide is a peptide hormone that belongs to the group of imines. It is the active substance in fulminant hepatitis and has been used as a diagnostic agent. It has been shown to increase serum alanine levels and decrease intracellular glutathione levels in the brain. N,N'-Bis(2-mercaptoethyl)isophthalamide has also been used as a pharmaceutical formulation for treatment of liver disease. The dosage ranges from 10 mg/kg to 20 mg/kg body weight per day.Formula:C12H16N2O2S2Purity:Min. 95%Molecular weight:284.4 g/mol






