CAS 35200-91-0
:5,5-dicyclopropyl-1,3-oxazolidin-2-one
Description:
5,5-Dicyclopropyl-1,3-oxazolidin-2-one is a cyclic compound characterized by its oxazolidinone structure, which features a five-membered ring containing both nitrogen and oxygen atoms. This compound is notable for its two cyclopropyl groups attached to the 5-position of the oxazolidinone ring, contributing to its unique steric and electronic properties. The presence of these cyclopropyl groups can enhance the compound's stability and influence its reactivity, making it of interest in various chemical applications, including medicinal chemistry and materials science. The oxazolidinone moiety is often associated with biological activity, particularly in the development of pharmaceuticals. Additionally, the compound may exhibit specific solubility characteristics and melting points that are influenced by its molecular structure. Its CAS number, 35200-91-0, allows for easy identification and reference in chemical databases. Overall, 5,5-dicyclopropyl-1,3-oxazolidin-2-one represents a versatile structure with potential applications in synthetic chemistry and drug development.
Formula:C9H13NO2
InChI:InChI=1/C9H13NO2/c11-8-10-5-9(12-8,6-1-2-6)7-3-4-7/h6-7H,1-5H2,(H,10,11)
SMILES:C1CC1C1(CN=C(O)O1)C1CC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.