CAS 352000-01-2

S-{2-[(7-sulfamoyl-2,1,3-benzoxadiazol-4-yl)amino]ethyl} methanesulfonothioate

Description:

S-{2-[(7-sulfamoyl-2,1,3-benzoxadiazol-4-yl)amino]ethyl} methanesulfonothioate is a chemical compound characterized by its complex structure, which includes a benzoxadiazole moiety and a sulfonothioate group. This compound features a sulfonamide functional group, which is known for its biological activity, particularly in medicinal chemistry. The presence of the benzoxadiazole ring contributes to its potential as a fluorescent probe or in photochemical applications. The methanesulfonothioate group enhances its reactivity and solubility in various solvents, making it suitable for diverse chemical reactions. Additionally, the compound may exhibit specific interactions with biological targets due to its sulfonamide and amine functionalities, suggesting potential applications in pharmaceuticals or agrochemicals. Its unique structural features may also impart specific physicochemical properties, such as stability under certain conditions and the ability to form hydrogen bonds, which can influence its behavior in biological systems or chemical environments. Overall, this compound represents a class of sulfonamide derivatives with potential utility in various scientific fields.

Formula: C₉H₁₂N₄O₅S₃

InChI: InChI=1/C9H12N4O5S3/c1-20(14,15)19-5-4-11-6-2-3-7(21(10,16)17)9-8(6)12-18-13-9/h2-3,11H,4-5H2,1H3,(H2,10,16,17)

SMILES: CS(=O)(=O)SCCNc1ccc(c2c1non2)S(=O)(=O)N

Synonyms:

• N-[4-(AMINOSULFONYL)-2,1,3-BENZOXADIAZOL-7-YL]-2-AMINOETHYL METHANETHIOSULFONATE
• ABD-MTS

N-[4-(Aminosulfonyl)-2,1,3-benzoxadiazol-7-yl]-2-aminoethyl methanethiosulfonate

CAS: 352000-01-2

Please enquire for more information about N-[4-(Aminosulfonyl)-2,1,3-benzoxadiazol-7-yl]-2-aminoethyl methanethiosulfonate including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₉H₁₂N₄O₅S₃

Purity: Min. 95%

Molecular weight: 352.41 g/mol

Ref: 3D-FA17849