CAS 35205-70-0
:3-Methyl-2-hexenoic acid (3:1 mixture of E and Z isomers)
Description:
3-Methyl-2-hexenoic acid, with the CAS number 35205-70-0, is an unsaturated carboxylic acid characterized by the presence of a double bond between the second and third carbon atoms in its hexenoic chain, along with a methyl group at the third position. This compound exists as a mixture of E (trans) and Z (cis) isomers, which differ in the spatial arrangement of substituents around the double bond, influencing their physical and chemical properties. Typically, such isomers exhibit different boiling points, solubility, and reactivity. 3-Methyl-2-hexenoic acid is a colorless to pale yellow liquid with a characteristic odor, and it is soluble in organic solvents but has limited solubility in water due to its hydrophobic hydrocarbon chain. This compound is of interest in organic synthesis and may serve as an intermediate in the production of various chemicals, including fragrances and pharmaceuticals. Its reactivity is influenced by the carboxylic acid functional group, allowing for typical acid-base reactions and esterification processes.
Formula:C7H12O2
InChI:InChI=1/C7H12O2/c1-3-4-6(2)5-7(8)9/h5H,3-4H2,1-2H3,(H,8,9)/b6-5+
Synonyms:- trans-3-Methyl-2-hexenoic acid
- 3-Methyl-2-hexenoic acid
- 2-Hexenoic acid, 3-methyl-, (E)-
- (2E)-3-methylhex-2-enoic acid
- 2-Hexenoic acid,3-methyl-, (2E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-methyl-2-Hexenoic acid
CAS:Formula:C7H12O2Purity:95%Color and Shape:SolidMolecular weight:128.16903-Methylhex-2-enoic acid
CAS:3-Methylhex-2-enoic acidPurity:98%Color and Shape:LiquidMolecular weight:128.17g/mol

