CAS 35207-71-7

3-chlorocyclobutanecarboxylic acid

Description:

3-Chlorocyclobutanecarboxylic acid is a cyclic carboxylic acid characterized by a cyclobutane ring with a carboxylic acid functional group and a chlorine substituent at the third carbon position. Its molecular structure includes four carbon atoms in the ring, one carboxylic acid group (-COOH), and one chlorine atom, which influences its reactivity and physical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It exhibits typical carboxylic acid properties, such as acidity and the ability to form hydrogen bonds, which can affect its solubility in polar solvents. The presence of the chlorine atom can enhance its reactivity, making it useful in organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. Additionally, the compound's unique structure may impart specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.

Formula: C₅H₇ClO₂

InChI: InChI=1/C5H7ClO2/c6-4-1-3(2-4)5(7)8/h3-4H,1-2H2,(H,7,8)

SMILES: C1C(CC1Cl)C(=O)O

Synonyms:

• Cyclobutanecarboxylic Acid, 3-Chloro-

3-Chlorocyclobutanecarboxylic acid

CAS: 35207-71-7

Formula: C₅H₇ClO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 134.5609

Ref: IN-DA007F3I

3-Chlorocyclobutane-1-carboxylic acid

CAS: 35207-71-7

3-Chlorocyclobutane-1-carboxylic acid

Purity: 97%

Molecular weight: 134.56g/mol

Ref: 54-OR921690

3-Chlorocyclobutanecarboxylic acid

CAS: 35207-71-7

Formula: C₅H₇ClO₂

Purity: 97%

Molecular weight: 134.56

Ref: 10-F219911