CAS 35212-85-2
:methyl 3-amino-1-benzothiophene-2-carboxylate
Description:
Methyl 3-amino-1-benzothiophene-2-carboxylate is an organic compound characterized by its unique structure, which includes a benzothiophene core, an amino group, and a carboxylate ester functional group. This compound typically appears as a solid or crystalline substance and is known for its potential applications in medicinal chemistry and organic synthesis. The presence of the amino group suggests it may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a versatile intermediate in the synthesis of more complex molecules. Additionally, the benzothiophene moiety contributes to its aromatic properties, which can influence its reactivity and interaction with biological systems. The methyl ester group enhances its solubility in organic solvents, facilitating its use in various chemical processes. Overall, methyl 3-amino-1-benzothiophene-2-carboxylate is a compound of interest due to its structural features and potential utility in pharmaceutical development and research.
Formula:C10H9NO2S
InChI:InChI=1/C10H9NO2S/c1-13-10(12)9-8(11)6-4-2-3-5-7(6)14-9/h2-5H,11H2,1H3
SMILES:COC(=O)c1c(c2ccccc2s1)N
Synonyms:- Benzo[b]thiophene-2-carboxylic acid, 3-amino-, methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 3-aminobenzo[b]thiophene-2-carboxylate, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C10H9NO2SPurity:97%Color and Shape:Cream to pale yellow, Crystals or powder or crystalline powderMolecular weight:207.25Methyl 3-Aminobenzo[b]thiophene-2-carboxylate
CAS:Formula:C10H9NO2SPurity:98%Color and Shape:SolidMolecular weight:207.2490Methyl 3-aminobenzo[b]thiophene-2-carboxylate
CAS:Methyl 3-aminobenzo[b]thiophene-2-carboxylateFormula:C10H9NO2SPurity:≥95%Color and Shape:Yellow-Brown PowderMolecular weight:207.25g/molMethyl 3-aminobenzo[b]thiophene-2-carboxylate
CAS:Formula:C10H9NO2SPurity:97.0%Color and Shape:SolidMolecular weight:207.25



