CymitQuimica logo

CAS 35212-95-4

:

methyl 4-chloro-1-benzothiophene-2-carboxylate

Description:
Methyl 4-chloro-1-benzothiophene-2-carboxylate is an organic compound characterized by its unique structure, which includes a benzothiophene ring system, a carboxylate functional group, and a chlorine substituent. This compound typically appears as a solid or liquid, depending on its purity and environmental conditions. It is known for its potential applications in medicinal chemistry and as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. The presence of the chlorine atom enhances its reactivity, making it a useful building block in organic synthesis. Additionally, the methyl ester group contributes to its solubility in organic solvents, facilitating its use in various chemical reactions. The compound's properties, such as boiling point, melting point, and solubility, can vary based on the specific conditions and purity levels. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance, to ensure safe laboratory practices.
Formula:C10H7ClO2S
InChI:InChI=1/C10H7ClO2S/c1-13-10(12)9-5-6-7(11)3-2-4-8(6)14-9/h2-5H,1H3
InChI key:CKXPDFHEOUVFRD-UHFFFAOYSA-N
SMILES:COC(=O)c1cc2c(cccc2s1)Cl
Synonyms:
  • Benzo[B]Thiophene-2-Carboxylic Acid, 4-Chloro-, Methyl Ester
  • Methyl 4-chlorobenzo[b]thiophene-2-carboxylate
  • Methyl-4-chlor-1-benzothiophen-2-carboxylat
Found 4 products.