
CAS 352211-11-1
:1,3,5-Triazine-2,4-diamine, 3,6-dihydro-N2,N2,6-trimethyl-, hydrochloride (1:1)
Description:
1,3,5-Triazine-2,4-diamine, 3,6-dihydro-N2,N2,6-trimethyl-, hydrochloride (1:1), with CAS number 352211-11-1, is a chemical compound characterized by its triazine ring structure, which is a six-membered aromatic heterocycle containing three nitrogen atoms. This compound features two amino groups at the 2 and 4 positions of the triazine ring, contributing to its reactivity and potential applications in various chemical processes. The presence of the trimethyl group enhances its solubility and stability in aqueous solutions. As a hydrochloride salt, it is typically encountered in a solid form, which can be easily dissolved in water or other polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research and agrochemical applications. Its unique structure allows for potential interactions with biological targets, and it may serve as a precursor or intermediate in the synthesis of more complex molecules. Safety data and handling precautions should be observed, as with all chemical substances, to ensure safe usage in laboratory or industrial settings.
Formula:C6H14ClN5
InChI:InChI=1S/C6H13N5.ClH/c1-4-8-5(7)10-6(9-4)11(2)3;/h4H,1-3H3,(H3,7,8,9,10);1H
InChI key:InChIKey=UXHLCYMTNMEXKZ-UHFFFAOYSA-N
SMILES:N(C)(C)C=1NC(C)N=C(N)N1.Cl
Synonyms:- 1,3,5-Triazine-2,4-diamine, 3,6-dihydro-N2,N2,6-trimethyl-, hydrochloride (1:1)
- 1,3,5-Triazine-2,4-diamine, 1,6-dihydro-N,N,6-trimethyl-, monohydrochloride
- rac-Imeglimin
- 2-amino-3,6-dihydro-4-dimethylamino-6-methyl-1,3,5-triazine hydrochloride
- 4-imino-N,N,6-trimethyl-1,4,5,6-tetrahydro-1,3,5-triazin-2- amine hydrochloride
- Imeglimin hydrochloride salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
