CAS 352276-28-9
:Latanoprost Lactol
Description:
Latanoprost lactol is a chemical compound primarily known for its application in ophthalmology, particularly in the treatment of glaucoma and ocular hypertension. It is a derivative of latanoprost, a prostaglandin analog that works by increasing the outflow of aqueous humor, thereby reducing intraocular pressure. The lactol form is characterized by its specific structural features, including a lactol functional group, which contributes to its biological activity. Latanoprost lactol is typically administered as an eye drop formulation and is known for its efficacy and relatively favorable safety profile. Common side effects may include ocular hyperemia, changes in iris pigmentation, and eyelash growth. The compound is also notable for its stability and solubility properties, which are crucial for its formulation in pharmaceutical products. As with any medication, it is essential to use latanoprost lactol under the guidance of a healthcare professional to ensure appropriate dosing and to monitor for potential adverse effects.
Formula:C39H52O8
InChI:InChI=1/C26H40O5.C13H12O3/c1-19(2)31-26(30)13-9-4-3-8-12-22-23(25(29)18-24(22)28)17-16-21(27)15-14-20-10-6-5-7-11-20;1-9(14)13(15)16-12-7-6-10-4-2-3-5-11(10)8-12/h3,5-8,10-11,19,21-25,27-29H,4,9,12-18H2,1-2H3;2-9,14H,1H3/b8-3-;/t21-,22+,23+,24-,25+;/m0./s1
Synonyms:- (3aR,4R,5R,6aS)-Hexahydro-4-[(3R)-3-hydroxy-5-phenylpentyl]-2H-cyclopenta[b]furan-2,5-diol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
(3aR,4R,5R,6aS)-4-((R)-3-Hydroxy-5-phenylpentyl)hexahydro-2H-cyclopenta[b]furan-2,5-diol
CAS:Formula:C18H26O4Color and Shape:LiquidMolecular weight:306.3966Latanoprost Impurity 6
CAS:Formula:C18H26O4Color and Shape:White To Off-White SolidMolecular weight:306.40


