CAS 35229-96-0

Ethyl 2-chloro-2-[2-(3-methylphenyl)hydrazinylidene]acetate

Description:

Ethyl 2-chloro-2-[2-(3-methylphenyl)hydrazinylidene]acetate, with the CAS number 35229-96-0, is a chemical compound characterized by its unique structure, which includes an ethyl ester group, a chloro substituent, and a hydrazine derivative. This compound typically appears as a solid or liquid, depending on its specific formulation and purity. It is known for its potential applications in organic synthesis and medicinal chemistry, particularly due to the presence of the hydrazine moiety, which can participate in various chemical reactions, including condensation and coupling reactions. The presence of the chloro group may enhance its reactivity, making it a useful intermediate in the synthesis of more complex organic molecules. Additionally, the aromatic ring from the 3-methylphenyl group can contribute to the compound's stability and influence its electronic properties. As with many chemical substances, safety precautions should be taken when handling this compound, as it may pose health risks or environmental hazards.

Formula: C₁₁H₁₃ClN₂O₂

InChI: InChI=1S/C11H13ClN2O2/c1-3-16-11(15)10(12)14-13-9-6-4-5-8(2)7-9/h4-7,13H,3H2,1-2H3

InChI key: InChIKey=AQNDVZFJEOKUPX-UHFFFAOYSA-N

SMILES: N(N=C(C(OCC)=O)Cl)C1=CC(C)=CC=C1

Synonyms:

• Acetic acid, chloro[(3-methylphenyl)hydrazono]-, ethyl ester
• Acetic acid, 2-chloro-2-[2-(3-methylphenyl)hydrazinylidene]-, ethyl ester
• Ethyl 2-chloro-2-[2-(3-methylphenyl)hydrazinylidene]acetate

ethyl (2Z)-2-chloro-2-[2-(3-methylphenyl)hydrazin-1-ylidene]acetate

CAS: 35229-96-0

Formula: C₁₁H₁₃ClN₂O₂

Purity: 95.0%

Molecular weight: 240.69

Ref: 10-F525391