CAS 352328-88-2

6-Bromo-7-chloro-2-(methylthio)pyrido[2,3-d]pyrimidine

Description:

6-Bromo-7-chloro-2-(methylthio)pyrido[2,3-d]pyrimidine is a heterocyclic compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound features a bromine atom at the 6-position and a chlorine atom at the 7-position, contributing to its reactivity and potential biological activity. The presence of a methylthio group at the 2-position enhances its solubility and may influence its pharmacological properties. Typically, compounds of this nature are of interest in medicinal chemistry due to their potential as therapeutic agents, particularly in the development of pharmaceuticals targeting various diseases. The molecular structure allows for various interactions with biological targets, making it a candidate for further research in drug development. Additionally, its unique halogen substitutions may impart specific electronic properties, affecting its behavior in chemical reactions and interactions. Overall, 6-Bromo-7-chloro-2-(methylthio)pyrido[2,3-d]pyrimidine represents a significant compound for study in both synthetic and medicinal chemistry contexts.

Formula: C₈H₅BrClN₃S

InChI: InChI=1S/C8H5BrClN3S/c1-14-8-11-3-4-2-5(9)6(10)12-7(4)13-8/h2-3H,1H3

InChI key: InChIKey=DNYVNIZXYMXNJS-UHFFFAOYSA-N

SMILES: S(C)C1=NC2=C(C=C(Br)C(Cl)=N2)C=N1

Synonyms:

• Pyrido[2,3-d]pyrimidine, 6-bromo-7-chloro-2-(methylthio)-
• 6-Bromo-7-chloro-2-(methylthio)pyrido[2,3-d]pyrimidine

Pyrido[2,3-d]pyrimidine, 6-bromo-7-chloro-2-(methylthio)-

CAS: 352328-88-2

Formula: C₈H₅BrClN₃S

Purity: 95%

Molecular weight: 290.5674

Ref: IN-DA01RHUS

6-Bromo-7-chloro-2-(methylthio)pyrido[2,3-d]pyrimidine

CAS: 352328-88-2

Purity: 95%

Molecular weight: 290.5599976

Ref: 10-F619109