CymitQuimica logo

CAS 352351-62-3

:

Fmoc-2,4-Dichloro-L-phenylalanine

Description:
Fmoc-2,4-Dichloro-L-phenylalanine is a derivative of the amino acid phenylalanine, modified with a fluorenylmethyloxycarbonyl (Fmoc) protecting group and two chlorine substituents at the 2 and 4 positions of the aromatic ring. This compound is typically used in peptide synthesis, particularly in solid-phase peptide synthesis (SPPS), where the Fmoc group serves as a protective group for the amino functionality, allowing for selective deprotection and coupling reactions. The presence of the dichloro substituents can influence the compound's reactivity and steric properties, potentially affecting the overall structure and function of peptides synthesized with this amino acid. Fmoc-2,4-Dichloro-L-phenylalanine is characterized by its stability under basic conditions and its solubility in organic solvents, making it suitable for various synthetic applications. Additionally, its unique electronic properties due to the chlorine atoms can impact the peptide's biological activity and interactions. As with all chemical substances, proper handling and safety precautions should be observed when working with this compound.
Formula:C24H19Cl2NO4
InChI:InChI=1/C24H19Cl2NO4/c25-15-10-9-14(21(26)12-15)11-22(23(28)29)27-24(30)31-13-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-10,12,20,22H,11,13H2,(H,27,30)(H,28,29)/t22-/m0/s1
InChI key:PGIMVGROPOKRNA-QFIPXVFZSA-N
SMILES:c1ccc2c(c1)c1ccccc1C2COC(=N[C@@H](Cc1ccc(cc1Cl)Cl)C(=O)O)O
Synonyms:
  • (2S)-3-(2,4-Dichlorophenyl)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}propanoic acid
  • 2,4-Dichloro-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-phenylalanine
  • L-phenylalanine, 2,4-dichloro-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-
  • Fmoc-L-2,4-Dichlorophe
Found 5 products.