CymitQuimica logo

CAS 352359-21-8

:

[1-(tert-butoxycarbonyl)-4-methyl-1H-indol-2-yl]boronic acid

Description:
[1-(tert-butoxycarbonyl)-4-methyl-1H-indol-2-yl]boronic acid is a boronic acid derivative characterized by the presence of a boron atom bonded to a phenyl group and an indole moiety. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The tert-butoxycarbonyl (Boc) group provides protection for the amine functionality, enhancing the compound's stability and reactivity under specific conditions. The presence of the methyl group on the indole ring can influence its electronic properties and steric hindrance, affecting its reactivity and interactions in chemical reactions. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are vital in the formation of carbon-carbon bonds in organic synthesis. Overall, this compound's unique structure and functional groups make it a valuable intermediate in the development of pharmaceuticals and other organic materials.
Formula:C14H18BNO4
InChI:InChI=1/C14H18BNO4/c1-9-6-5-7-11-10(9)8-12(15(18)19)16(11)13(17)20-14(2,3)4/h5-8,18-19H,1-4H3
InChI key:InChIKey=ZJNLBPIVJPNKSK-UHFFFAOYSA-N
SMILES:Cc1cccc2c1cc(B(O)O)n2C(=O)OC(C)(C)C
Synonyms:
  • [1-(tert-Butoxycarbonyl)-4-methyl-1H-indol-2-yl]boronic acid
Found 4 products.