CAS 3524-13-8

1-(1-phenylethyl)-1H-pyrazol-5-amine

Description:

1-(1-phenylethyl)-1H-pyrazol-5-amine, with the CAS number 3524-13-8, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a phenylethyl group, which contributes to its hydrophobic characteristics and potential biological activity. The presence of an amine functional group enhances its reactivity and solubility in polar solvents. Typically, compounds like this may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic applications. Additionally, the compound's stability, solubility, and reactivity can be influenced by factors such as pH and the presence of other functional groups. Overall, 1-(1-phenylethyl)-1H-pyrazol-5-amine is a compound of interest in both synthetic and medicinal chemistry due to its unique structural features and potential applications.

Formula: C₁₁H₁₃N₃

InChI: InChI=1/C11H13N3/c1-9(10-5-3-2-4-6-10)14-11(12)7-8-13-14/h2-9H,12H2,1H3

SMILES: CC(c1ccccc1)n1c(ccn1)N

1-(1-Phenylethyl)-1H-pyrazol-5-amine

CAS: 3524-13-8

Formula: C₁₁H₁₃N₃

Molecular weight: 187.2410

Ref: IN-DA007F2N

2-(1-Phenyl-ethyl)-2H-pyrazol-3-ylamine

CAS: 3524-13-8

Formula: C₁₁H₁₃N₃

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 187.246

Ref: 10-F058109

2-(1-Phenyl-ethyl)-2H-pyrazol-3-ylamine

CAS: 3524-13-8

Versatile small molecule scaffold

Formula: C₁₁H₁₃N₃

Purity: Min. 95%

Molecular weight: 187.24 g/mol

Ref: 3D-DAA52413