CAS 3524-27-4

1-[[4-(Dimethylamino)phenyl]methyl]-1H-pyrazol-5-amine

Description:

1-[[4-(Dimethylamino)phenyl]methyl]-1H-pyrazol-5-amine, with the CAS number 3524-27-4, is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a dimethylamino group attached to a phenyl ring, contributing to its potential as a biological or pharmacological agent. The presence of the amine functional group indicates that it can participate in hydrogen bonding, which may influence its solubility and reactivity. Typically, compounds like this may exhibit properties such as moderate to high polarity due to the presence of nitrogen atoms and functional groups, which can affect their interaction with biological systems. Additionally, the structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and heterocyclic components. However, specific physical properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for precise applications and handling guidelines.

Formula: C₁₂H₁₆N₄

InChI: InChI=1S/C12H16N4/c1-15(2)11-5-3-10(4-6-11)9-16-12(13)7-8-14-16/h3-8H,9,13H2,1-2H3

InChI key: InChIKey=NURZXYPEYWICFY-UHFFFAOYSA-N

SMILES: C(N1C(N)=CC=N1)C2=CC=C(N(C)C)C=C2

Synonyms:

• 2-(4-Dimethylamino-benzyl)-2H-pyrazol-3-ylamine
• Pyrazole, 5-amino-1-[p-(dimethylamino)benzyl]-
• 1-(4-(Dimethylamino)benzyl)-1H-pyrazol-5-amine
• 1-[[4-(Dimethylamino)phenyl]methyl]-1H-pyrazol-5-amine
• 1H-Pyrazol-5-amine, 1-[[4-(dimethylamino)phenyl]methyl]-

1-{[4-(Dimethylamino)phenyl]methyl}-1H-pyrazol-5-amine

CAS: 3524-27-4

Versatile small molecule scaffold

Formula: C₁₂H₁₆N₄

Purity: Min. 95%

Molecular weight: 216.28 g/mol

Ref: 3D-DAA52427