CymitQuimica logo

CAS 3524-30-9

:

1-(1-methylpiperidin-4-yl)-1H-pyrazol-5-amine

Description:
1-(1-Methylpiperidin-4-yl)-1H-pyrazol-5-amine, with the CAS number 3524-30-9, is a chemical compound characterized by its unique structure that includes a pyrazole ring and a piperidine moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents. The presence of the amine functional group suggests it may engage in hydrogen bonding, influencing its reactivity and interactions with other molecules. It is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The methyl group on the piperidine ring can affect the compound's lipophilicity and overall pharmacokinetic properties. Additionally, the compound may exhibit specific biological activities, making it of interest in various research fields, including drug discovery and development. As with any chemical substance, safety and handling precautions should be observed, given the potential for toxicity or reactivity.
Formula:C9H16N4
InChI:InChI=1/C9H16N4/c1-12-6-3-8(4-7-12)13-9(10)2-5-11-13/h2,5,8H,3-4,6-7,10H2,1H3
InChI key:QCNNKYQIYTZXJX-UHFFFAOYSA-N
SMILES:CN1CCC(CC1)n1c(ccn1)N
Synonyms:
  • 1H-Pyrazol-5-amine, 1-(1-methyl-4-piperidinyl)-
  • 1-(1-Methylpiperidin-4-yl)-1H-pyrazol-5-amine
Found 2 products.