CAS 352431-15-3
:2-(4-chloro-2,3,5-trideuterio-6-methyl-phenoxy)propanoic acid
Description:
2-(4-chloro-2,3,5-trideuterio-6-methyl-phenoxy)propanoic acid, identified by its CAS number 352431-15-3, is a chemical compound that belongs to the class of phenoxypropanoic acids. This substance features a phenoxy group, which is a phenyl ring bonded to an ether oxygen, and a propanoic acid moiety, indicating the presence of a carboxylic acid functional group. The presence of a chlorine atom and deuterium isotopes on the aromatic ring suggests that this compound may be used in studies involving isotopic labeling, which can help trace metabolic pathways or interactions in biological systems. The methyl group on the phenyl ring can influence the compound's lipophilicity and biological activity. As with many phenoxy acids, this compound may exhibit herbicidal properties, making it of interest in agricultural chemistry. Its specific characteristics, such as solubility, stability, and reactivity, would depend on the molecular structure and the presence of substituents, which can significantly affect its behavior in various chemical environments.
Formula:C10H8D3ClO3
InChI:InChI=1/C10H11ClO3/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13/h3-5,7H,1-2H3,(H,12,13)/i3D,4D,5D
SMILES:Cc1c(c(c(c(c1OC(C)C(=O)O)[2H])[2H])Cl)[2H]
Synonyms:- 2-{[4-Chloro-2-methyl(2
- Propanoic Acid, 2-[(4-Chloro-6-Methylphenyl-2,3,5-D3
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(+/-)-2-(4-Chloro-2-methyl-phenoxy-d3)propionic Acid(Mecoprop-d3)
CAS:Purity:98 atom % DColor and Shape:White SolidMolecular weight:217.67Mecoprop D3 (phenyl D3) 100 µg/mL in Acetone
CAS:Controlled ProductFormula:C10H3H8ClO3Color and Shape:Single SolutionMolecular weight:217.66Mizolastine Impurity 2
CAS:Formula:C22H25FN4OColor and Shape:White To Off-White SolidMolecular weight:380.47Mecoprop-d3
CAS:Controlled ProductApplications Labelled Mecoprop (M203052). Herbicide.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Gagne, F., et al.: Environ. Res., 103, 238 (2007), LaChapelle, A., et al.: Reprod. Toxicol., 23, 20 (2007),Formula:C102H3H8ClO3Color and Shape:NeatMolecular weight:217.66



