CAS 352431-47-1

2,2-dideuterio-3-methyl-butanal

Description:

2,2-Dideuterio-3-methyl-butanal is an organic compound characterized by its structure, which includes a butanal backbone with a methyl group and two deuterium atoms substituting hydrogen atoms. The presence of deuterium, a stable isotope of hydrogen, imparts unique properties to the compound, such as altered physical and chemical behavior compared to its non-deuterated analog. This compound is likely to be a colorless liquid at room temperature, exhibiting typical aldehyde characteristics, including a distinct odor and reactivity with nucleophiles. It may participate in various chemical reactions, such as oxidation and condensation, due to the aldehyde functional group. The deuterium substitution can also influence the compound's vibrational spectra, making it useful in studies involving isotopic labeling and tracing in chemical and biological research. Additionally, its CAS number, 352431-47-1, allows for easy identification in chemical databases, facilitating research and application in fields such as organic synthesis and analytical chemistry.

Formula: C₅H₈D₂O

InChI: InChI=1/C5H10O/c1-5(2)3-4-6/h4-5H,3H2,1-2H3/i3D2

SMILES: CC(C)C(C=O)([2H])[2H]

Synonyms:

• 3-Methyl(2,2-< sup> 2< /sup> H< sub> 2< /sub> )butanal
• Butanal-2,2-D< Sub> 2< /Sub> , 3-Methyl-

3-Methylbutanal(2,2-D2)

CAS: 352431-47-1

3-Methylbutanal(2,2-D2)

Purity: 98%

Molecular weight: 88.14462g/mol

Ref: 54-BIM0590

3-Methylbutyraldehyde-2,2-d2

CAS: 352431-47-1

Formula: (CH₃)₂CHCD₂CHO

Purity: 98 atom % D

Color and Shape: Colorless Liquid.

Molecular weight: 88.08572

Ref: 3U-D5269

3-Methylbutyraldehyde-2,2-d2

Controlled Product

CAS: 352431-47-1

Applications 3-Methylbutyraldehyde-2,2-d2 (CAS# 352431-47-1) is a useful isotopically labeled research compound.

Formula: C₅D₂H₈O

Color and Shape: Neat

Molecular weight: 88.145

Ref: TR-V091301