CAS 352437-09-3
:tert-butyl 4-(4-bromophenyl)piperazine-1-carboxylate
Description:
Tert-butyl 4-(4-bromophenyl)piperazine-1-carboxylate is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a tert-butyl group, which enhances its lipophilicity and steric bulk, potentially influencing its biological activity and solubility. The presence of a 4-bromophenyl substituent introduces a bromine atom, which can affect the compound's electronic properties and reactivity. The carboxylate functional group contributes to the compound's acidity and can participate in various chemical reactions, such as esterification or amidation. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Its specific properties, such as melting point, solubility, and stability, would depend on the molecular interactions and the environment in which it is studied. Overall, tert-butyl 4-(4-bromophenyl)piperazine-1-carboxylate represents a versatile scaffold for further chemical exploration and potential therapeutic applications.
Formula:C15H21BrN2O2
InChI:InChI=1/C15H21BrN2O2/c1-15(2,3)20-14(19)18-10-8-17(9-11-18)13-6-4-12(16)5-7-13/h4-7H,8-11H2,1-3H3
SMILES:CC(C)(C)OC(=O)N1CCN(CC1)c1ccc(cc1)Br
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
tert-Butyl 4-(4-Bromophenyl)piperazine-1-carboxylate
CAS:Formula:C15H21BrN2O2Purity:>98.0%(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:341.251-Boc-4-(4-Bromophenyl)piperazine
CAS:Formula:C15H21BrN2O2Purity:97%Color and Shape:SolidMolecular weight:341.24344-(4-Bromophenyl)piperazine, N1-BOC protected
CAS:<p>4-(4-Bromophenyl)piperazine, N1-BOC protected</p>Purity:97%Color and Shape:PowderMolecular weight:341.24g/moltert-Butyl 4-(4-bromophenyl)piperazine-1-carboxylate
CAS:Formula:C15H21BrN2O2Purity:98%Color and Shape:Solid, Crystalline Powder or PowderMolecular weight:341.2494-(4-Bromophenyl)piperazine-1-carboxylic acid tert-butyl ester
CAS:Controlled Product<p>Please enquire for more information about 4-(4-Bromophenyl)piperazine-1-carboxylic acid tert-butyl ester including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C15H21BrN2O2Purity:Min. 95%Molecular weight:341.24 g/mol




