CAS 352439-37-3
:23-Amino-3,6,9,12,15,18,21-heptaoxatricosan-1-ol
Description:
23-Amino-3,6,9,12,15,18,21-heptaoxatricosan-1-ol is a complex organic compound characterized by its long carbon chain and multiple ether linkages due to the presence of seven oxygen atoms in its structure. The "amino" group indicates the presence of a primary amine, which can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. The heptaoxatricosan structure suggests that it is a polyether, which may exhibit unique solubility properties and potential applications in surfactants or polymer chemistry. The presence of hydroxyl (-OH) groups contributes to its hydrophilicity, enhancing its interaction with water and other polar solvents. This compound may also exhibit biological activity due to the amino group, making it of interest in medicinal chemistry. Its specific properties, such as melting point, boiling point, and reactivity, would depend on the overall molecular structure and the arrangement of functional groups. Further studies would be necessary to fully elucidate its characteristics and potential applications in various fields.
Formula:C16H35NO8
InChI:InChI=1S/C16H35NO8/c17-1-3-19-5-7-21-9-11-23-13-15-25-16-14-24-12-10-22-8-6-20-4-2-18/h18H,1-17H2
InChI key:InChIKey=DGWYLEGXXDZPEY-UHFFFAOYSA-N
SMILES:O(CCOCCOCCOCCN)CCOCCOCCOCCO
Synonyms:- 23-Amino-3,6,9,12,15,18,21-heptaoxatricosan-1-ol
- 3,6,9,12,15,18,21-Heptaoxatricosan-1-ol, 23-amino-
- 23-Amino-3,6,9,12,15,18,21-heptaoxatricosanol
- 2-[2-[2-[2-[2-[2-[2-(2-Aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1-Aminooctaethylene Glycol
CAS:Formula:C16H35NO8Purity:95%Color and Shape:LiquidMolecular weight:369.4510NH2-PEG8-OH
CAS:<p>NH2-PEG8-OH is a PEG-based linker for PROTACs which joins two essential ligands, crucial for forming PROTAC molecules.</p>Formula:C16H35NO8Purity:98%Color and Shape:SolidMolecular weight:369.4523-Amino-3,6,9,12,15,18,21-heptaoxatricosan-1-ol
CAS:Purity:95%Color and Shape:Viscous LiquidMolecular weight:369.45498661-Aminooctaethylene glycol
CAS:<p>1-Aminooctaethylene glycol is a PEG polymer categorised as monofunctional (OH-PEG-X). Used as a linker, 1-aminooctaethylene glycol is used to attached PEG to proteins, peptides, oligonucleotides, nanoparticles and small molecules via pegylation, a bioconjugation technique.</p>Formula:C16H35NO8Purity:Min. 95%Color and Shape:PowderMolecular weight:369.45 g/molAmino-dPEG®8-OH
CAS:<p>Amino-dPEG®8-OH is a PEG polymer categorised as monofunctional (OH-PEG-X). Used as a linker, amino-dPEG®8-OH is used to attached PEG to proteins, peptides, oligonucleotides, nanoparticles and small molecules via pegylation, a bioconjugation technique.</p>Formula:C16H35NO8Purity:Min. 95%Molecular weight:369.45 g/mol




