CAS 352457-34-2

5-[(4,5-Dihydro-1H-imidazol-2-yl)amino]-6-methoxy-2-methyl-4(3H)-pyrimidinone

Description:

5-[(4,5-Dihydro-1H-imidazol-2-yl)amino]-6-methoxy-2-methyl-4(3H)-pyrimidinone, with CAS number 352457-34-2, is a chemical compound characterized by its complex structure, which includes a pyrimidinone core substituted with an imidazole moiety. This compound typically exhibits properties such as solubility in polar solvents, which is common for many pyrimidine derivatives. It may possess biological activity, potentially acting as an inhibitor or modulator in various biochemical pathways, making it of interest in pharmaceutical research. The presence of both methoxy and amino functional groups suggests that it may engage in hydrogen bonding, influencing its reactivity and interaction with biological targets. Additionally, the compound's molecular structure indicates potential for diverse applications in medicinal chemistry, particularly in the development of therapeutics targeting specific diseases. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function, highlighting the importance of such derivatives in drug discovery and development.

Formula: C₉H₁₃N₅O₂

InChI: InChI=1S/C9H13N5O2/c1-5-12-7(15)6(8(13-5)16-2)14-9-10-3-4-11-9/h3-4H2,1-2H3,(H2,10,11,14)(H,12,13,15)

InChI key: InChIKey=MFFANMLJBOSKIX-UHFFFAOYSA-N

SMILES: N(C1=C(OC)NC(C)=NC1=O)C=2NCCN2

Synonyms:

• 5-[(4,5-Dihydro-1H-imidazol-2-yl)amino]-6-methoxy-2-methyl-4(3H)-pyrimidinone
• 4(1H)-Pyrimidinone, 5-[(4,5-dihydro-1H-imidazol-2-yl)amino]-6-methoxy-2-methyl-
• 4(3H)-Pyrimidinone, 5-[(4,5-dihydro-1H-imidazol-2-yl)amino]-6-methoxy-2-methyl-

Moxonidine EP Impurity C (4-Hydroxymoxonidine)

CAS: 352457-34-2

Formula: C₉H₁₃N₅O₂

Color and Shape: White To Off-White Solid

Molecular weight: 223.24

Ref: 4Z-M-376

4-Hydroxy Moxonidine

Controlled Product

CAS: 352457-34-2

Formula: C₉H₁₃N₅O₂

Color and Shape: Neat

Molecular weight: 223.23

Ref: TR-H947735

4-Hydroxy moxonidine

CAS: 352457-34-2

4-Hydroxy moxonidine (4HM) is a metabolite of moxonidine. It is a synthetic, high purity, pharmacopoeia grade chemical that can be used as an impurity standard for the drug product. Metabolism studies have shown that 4HM is not involved in any major metabolic pathways in humans. The CAS number for 4HM is 352457-34-2.

Formula: C₉H₁₃N₅O₂

Purity: Min. 95%

Molecular weight: 223.23 g/mol

Ref: 3D-CPA45734