CymitQuimica logo

CAS 3525-22-2

:

4-(4-methoxyphenoxy)benzoic acid

Description:
4-(4-Methoxyphenoxy)benzoic acid, with the CAS number 3525-22-2, is an organic compound characterized by its aromatic structure and functional groups. It features a benzoic acid moiety, which includes a carboxylic acid group (-COOH) attached to a benzene ring, and a methoxyphenoxy group, where a methoxy group (-OCH3) is substituted on a phenyl ring that is further connected to another phenyl ring via an ether linkage. This compound is typically a white to off-white solid and is soluble in organic solvents, but its solubility in water is limited due to its hydrophobic aromatic structure. It exhibits properties typical of aromatic acids, such as the ability to form hydrogen bonds and participate in various chemical reactions, including esterification and nucleophilic substitutions. Its unique structure may impart specific biological activities, making it of interest in pharmaceutical and material science research. Additionally, it can serve as a building block in organic synthesis and may have applications in the development of polymers or as an intermediate in the synthesis of other chemical compounds.
Formula:C14H12O4
InChI:InChI=1/C14H12O4/c1-17-11-6-8-13(9-7-11)18-12-4-2-10(3-5-12)14(15)16/h2-9H,1H3,(H,15,16)
InChI key:COMKNVCMWUGEPO-UHFFFAOYSA-N
SMILES:COc1ccc(cc1)Oc1ccc(cc1)C(=O)O
Synonyms:
  • Benzoic Acid, 4-(4-Methoxyphenoxy)-
  • 4-(4-Methoxyphenoxy)benzoic acid
Found 4 products.