CAS 352525-82-7: 5-Bromo-2-ethoxyphenylboronic acid
Description:5-Bromo-2-ethoxyphenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a bromine atom and an ethoxy group attached to a phenyl ring, contributing to its unique reactivity and solubility properties. Typically, boronic acids are utilized in organic synthesis, particularly in Suzuki-Miyaura cross-coupling reactions, which are essential for forming carbon-carbon bonds. The presence of the bromine substituent enhances its electrophilic character, making it a valuable intermediate in the synthesis of various pharmaceuticals and agrochemicals. Additionally, the ethoxy group can influence the compound's solubility in organic solvents, facilitating its use in diverse chemical reactions. Overall, 5-Bromo-2-ethoxyphenylboronic acid is a versatile reagent in synthetic organic chemistry, with applications extending to materials science and medicinal chemistry.
Formula:C8H10BBrO3
InChI:InChI=1S/C8H10BBrO3/c1-2-13-8-4-3-6(10)5-7(8)9(11)12/h3-5,11-12H,2H2,1H3
InChI key:InChIKey=PMWQJPWDAQROND-UHFFFAOYSA-N
SMILES:BrC1=CC=C(OCC)C(=C1)B(O)O
- Synonyms:
- Boronic acid, (5-bromo-2-ethoxyphenyl)-
- Boronic acid, B-(5-bromo-2-ethoxyphenyl)-
- 5-Bromo-2-ethoxyphenylboronic acid
- B-(5-Bromo-2-ethoxyphenyl)boronic acid
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 5-BROMO-2-ETHOXYPHENYLBORONIC ACID REF: IN-DA00C0C5CAS: 352525-82-7 | 98% | 52.00 €~268.00 € | Tue 06 May 25 |
![]() | 5-Bromo-2-ethoxyphenylboronic acid REF: 54-OR360239CAS: 352525-82-7 | 98% | 45.00 €~382.00 € | Mon 05 May 25 |
![]() | 5-Bromo-2-ethoxyphenylboronic acid REF: 3D-CPA52582CAS: 352525-82-7 | Min. 95% | - - - | Discontinued product |

5-BROMO-2-ETHOXYPHENYLBORONIC ACID
Ref: IN-DA00C0C5
1g | 52.00 € | ||
5g | 127.00 € | ||
25g | 268.00 € |

Ref: 54-OR360239
1g | 45.00 € | ||
5g | 129.00 € | ||
25g | 382.00 € |

5-Bromo-2-ethoxyphenylboronic acid
Ref: 3D-CPA52582
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information |