CAS 352530-24-6
:4-(Ethanesulphonyl)benzeneboronic acid
Description:
4-(Ethanesulphonyl)benzeneboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a benzene ring, which is further substituted with an ethanesulphonyl group. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar solvents like water and methanol, and having a moderate melting point. The boronic acid moiety allows for participation in various chemical reactions, including Suzuki coupling, making it valuable in organic synthesis and medicinal chemistry. The ethanesulphonyl group enhances its solubility and may influence its reactivity and biological activity. Additionally, this compound may exhibit properties such as acidity due to the boronic acid group, which can form stable complexes with diols and other nucleophiles. Its unique structure and functional groups make it a useful intermediate in the synthesis of pharmaceuticals and agrochemicals. As with many organoboron compounds, careful handling and storage are recommended due to potential reactivity and stability concerns.
Formula:C8H11BO4S
InChI:InChI=1/C8H11BO4S/c1-2-14(12,13)8-5-3-7(4-6-8)9(10)11/h3-6,10-11H,2H2,1H3
SMILES:CCS(=O)(=O)c1ccc(cc1)B(O)O
Synonyms:- 4-(Ethylsulfonyl)phenylboronic acid
- 4-(Ethylsulphonyl)phenylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-(Ethylsulfonyl)benzeneboronic acid, 98+%
CAS:It is an important organic intermediate used in agrochemicals, pharmaceuticals and dyestuff fields. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar
Formula:C8H11BO4SPurity:98+%Color and Shape:White to pale cream, PowderMolecular weight:214.04(4-(Ethylsulfonyl)phenyl)boronic acid
CAS:Formula:C8H11BO4SPurity:96%Color and Shape:SolidMolecular weight:214.04654-(Ethylsulphonyl)benzeneboronic acid
CAS:4-(Ethylsulphonyl)benzeneboronic acidFormula:C8H11BO4SPurity:97%Color and Shape: white solidMolecular weight:214.05g/mol4-(Ethanesulfonyl)phenylboronic acid
CAS:Formula:C8H11BO4SPurity:96%Color and Shape:SolidMolecular weight:214.044-Ethylsulfonylphenylboronic acid
CAS:Controlled ProductApplications 4-Ethylsulfonylphenylboronic acid is used in the discovery of small molecular RIP1 kinase inhibitors for the treatment of pathologies associated with necroptosis.
References Harris, P. A,, et al.: ACS Med. Chem. Lett., 4, 1238 (2013)Formula:C8H11BO4SColor and Shape:NeatMolecular weight:214.05




