CAS 352530-25-7
:5-Formyl-4-methylthiophene-2-boronic acid
Description:
5-Formyl-4-methylthiophene-2-boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its reactivity in various organic synthesis applications, particularly in Suzuki coupling reactions. This compound features a thiophene ring, which contributes to its aromatic properties and potential electronic characteristics. The formyl group (-CHO) attached to the thiophene enhances its reactivity, making it suitable for further functionalization. The methylthio group (-S-CH3) at the 4-position of the thiophene ring can influence the compound's solubility and electronic properties. Typically, boronic acids are utilized in medicinal chemistry and materials science due to their ability to form stable complexes with diols and their role in the synthesis of complex organic molecules. The compound's structure suggests it may exhibit interesting properties such as fluorescence or conductivity, depending on the specific conditions and substituents involved. Overall, 5-Formyl-4-methylthiophene-2-boronic acid is a versatile building block in organic synthesis and materials development.
Formula:C6H7BO3S
InChI:InChI=1/C6H7BO3S/c1-4-2-6(7(9)10)11-5(4)3-8/h2-3,9-10H,1H3
SMILES:Cc1cc(B(O)O)sc1C=O
Synonyms:- (5-Formyl-4-Methyl-2-Thienyl)Boronic Acid
- 5-Formyl-4-methylthiophene-2-boronic acid, 97%
- 5-Borono-3-methylthiophene-2-carboxaldehyde
- 5-formyl-4-methylthiophen-2-ylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Formyl-4-methylthiophene-2-boronic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H7BO3SPurity:97%Color and Shape:Pale orange to pink, PowderMolecular weight:169.995-Borono-3-methylthiophene-2-carboxaldehyde
CAS:Formula:C6H7BO3SPurity:98%Color and Shape:SolidMolecular weight:169.99405-Borono-3-methylthiophene-2-carboxaldehyde
CAS:5-Borono-3-methylthiophene-2-carboxaldehydePurity:98%Molecular weight:169.99g/mol



