CAS 352530-45-1
:(2S)-1-chloro-3-(4-fluorophenoxy)propan-2-ol
Description:
(2S)-1-chloro-3-(4-fluorophenoxy)propan-2-ol, with the CAS number 352530-45-1, is a chiral organic compound characterized by its specific stereochemistry and functional groups. It features a propanol backbone with a chlorine atom and a 4-fluorophenoxy group attached, contributing to its unique chemical properties. The presence of the chiral center at the second carbon atom indicates that it can exist in two enantiomeric forms, which may exhibit different biological activities. This compound is likely to be soluble in polar solvents due to the hydroxyl group, while the aromatic fluorophenoxy moiety may enhance its lipophilicity. Its structure suggests potential applications in pharmaceuticals or agrochemicals, where the specific arrangement of atoms can influence reactivity and interaction with biological targets. Additionally, the chlorine and fluorine substituents may impart specific electronic properties, affecting the compound's reactivity and stability. Overall, (2S)-1-chloro-3-(4-fluorophenoxy)propan-2-ol is a compound of interest in synthetic chemistry and medicinal applications.
Formula:C9H10ClFO2
InChI:InChI=1/C9H10ClFO2/c10-5-8(12)6-13-9-3-1-7(11)2-4-9/h1-4,8,12H,5-6H2/t8-/m1/s1
SMILES:c1cc(ccc1F)OC[C@@H](CCl)O
Synonyms:- 18123-81-4
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
