CAS 352535-00-3

(2R)-2-[fluoro(diphenyl)methyl]pyrrolidine

Description:

(2R)-2-[fluoro(diphenyl)methyl]pyrrolidine is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered nitrogen-containing heterocycle. The presence of a fluorine atom and a diphenylmethyl group at the second position of the pyrrolidine ring contributes to its unique properties. This compound is typically a chiral molecule, with the (2R) designation indicating the specific stereochemistry at the chiral center. The fluorine substituent can influence the compound's reactivity and biological activity, often enhancing lipophilicity and altering pharmacokinetic properties. Diphenylmethyl groups are known to provide steric bulk, which can affect the compound's interaction with biological targets. As a result, (2R)-2-[fluoro(diphenyl)methyl]pyrrolidine may exhibit potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific characteristics, including solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups in a given formulation or reaction environment.

Formula: C₁₇H₁₈FN

InChI: InChI=1/C17H18FN/c18-17(16-12-7-13-19-16,14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-11,16,19H,7,12-13H2/t16-/m1/s1

SMILES: c1ccc(cc1)C(c1ccccc1)([C@H]1CCCN1)F

Synonyms:

• 352535-00-3

(R)-(+)-2-(Fluorodiphenylmethyl)pyrrolidine

CAS: 352535-00-3

Formula: C₁₇H₁₈FN

Molecular weight: 255.3299

Ref: IN-DA003C51

(R)-(+)-2-(Fluorodiphenylmethyl)pyrrolidine

CAS: 352535-00-3

(R)-(+)-2-(Fluorodiphenylmethyl)pyrrolidine

Purity: ≥95%

Molecular weight: 255.33g/mol

Ref: 54-PC301000