CAS 352535-97-8
:(3-bromo-2-fluorophenyl)boronic acid
Description:
(3-Bromo-2-fluorophenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is substituted with both bromine and fluorine atoms. The molecular structure features a boron atom bonded to a hydroxyl group and an aromatic ring, which enhances its reactivity in various chemical reactions, particularly in Suzuki coupling reactions, where it serves as a key reagent for the formation of carbon-carbon bonds. The presence of the bromine and fluorine substituents influences the electronic properties of the aromatic ring, potentially enhancing its reactivity and solubility in organic solvents. This compound is typically used in organic synthesis and medicinal chemistry, where it may play a role in the development of pharmaceuticals. Additionally, its boronic acid functionality allows for the formation of reversible covalent bonds with diols, making it useful in sensor applications and materials science. As with many organoboron compounds, handling should be done with care due to potential reactivity and toxicity.
Formula:C6H5BBrFO2
InChI:InChI=1S/C6H5BBrFO2/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3,10-11H
SMILES:c1cc(c(c(c1)Br)F)B(O)O
Synonyms:- boronic acid, B-(3-bromo-2-fluorophenyl)-
- 3-Bromo-2-Fluorophenylboronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Bromo-2-fluorophenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C6H5BBrFO2Purity:min. 98.0 area%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:218.823-Bromo-2-fluorophenylboronic acid
CAS:Formula:C6H5BBrFO2Purity:95%Color and Shape:SolidMolecular weight:218.81613-Bromo-2-fluorobenzeneboronic acid
CAS:3-Bromo-2-fluorobenzeneboronic acidFormula:C6H5BBrFO2Purity:≥95%Color and Shape: off white powderMolecular weight:218.82g/mol(3-Bromo-2-fluorophenyl)boronic acid
CAS:Formula:C6H5BBrFO2Purity:95%Color and Shape:SolidMolecular weight:218.82



