CAS 352553-09-4

1-(5-hydroxynaphtho[1,2-b]furan-3-yl)ethanone

Description:

1-(5-Hydroxynaphtho[1,2-b]furan-3-yl)ethanone, with the CAS number 352553-09-4, is an organic compound characterized by its complex structure, which includes a naphtho-furan moiety and a ketone functional group. This compound features a hydroxyl group (-OH) that contributes to its potential reactivity and solubility in polar solvents. The presence of the naphthalene ring system suggests that it may exhibit aromatic properties, which can influence its stability and interactions with other molecules. The ethanone group indicates that it is a ketone, which can participate in various chemical reactions, such as nucleophilic additions. This compound may also possess biological activity, making it of interest in medicinal chemistry and pharmacology. Its unique structure may allow for specific interactions with biological targets, potentially leading to applications in drug development. Overall, the characteristics of this compound make it a subject of interest for further research in both synthetic and applied chemistry contexts.

Formula: C₁₄H₁₀O₃

InChI: InChI=1/C14H10O3/c1-8(15)12-7-17-14-10-5-3-2-4-9(10)13(16)6-11(12)14/h2-7,16H,1H3

SMILES: CC(=O)c1coc2c3ccccc3c(cc12)O

Synonyms:

• 1-(5-Hydroxy-naphtho[1,2-b]furan-3-yl)-ethanone
• Ethanone, 1-(5-hydroxynaphtho[1,2-b]furan-3-yl)-
• 1-(5-Hydroxynaphtho[1,2-b]furan-3-yl)ethanone

1-(5-hydroxynaphtho[1,2-b]furan-3-yl)ethanone

CAS: 352553-09-4

Purity: 95.0%

Molecular weight: 226.2310028076172

Ref: 10-F313887