CAS 35261-06-4

5-amino-3-methylisoxazole-4-carboxamide

Description:

5-Amino-3-methylisoxazole-4-carboxamide is a heterocyclic organic compound characterized by its isoxazole ring structure, which features both nitrogen and oxygen atoms. This compound contains an amino group (-NH2) and a carboxamide group (-C(=O)NH2), contributing to its polar nature and potential for hydrogen bonding. The presence of the methyl group at the 3-position of the isoxazole ring influences its solubility and reactivity. Typically, compounds like this exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure allows for various interactions with biological targets, which may include enzyme inhibition or modulation of receptor activity. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 5-amino-3-methylisoxazole-4-carboxamide is a versatile compound with potential applications in medicinal chemistry and drug development.

Formula: C₅H₇N₃O₂

InChI: InChI=1/C5H7N3O2/c1-2-3(4(6)9)5(7)10-8-2/h7H2,1H3,(H2,6,9)

SMILES: Cc1c(C(=N)O)c(N)on1

5-Amino-3-methyl-4-isoxazolecarboxamide

CAS: 35261-06-4

Formula: C₅H₇N₃O₂

Molecular weight: 141.1280

Ref: IN-DA00C8OU

5-Amino-3-methyl-4-isoxazolecarboxamide

CAS: 35261-06-4

5-Amino-3-methyl-4-isoxazolecarboxamide

Purity: ≥95%

Molecular weight: 141.13g/mol

Ref: 54-OR53179

5-amino-3-methyl-4-isoxazolecarboxamide

CAS: 35261-06-4

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 141.1300048828125

Ref: 10-F313011

5-Amino-3-methyl-4-isoxazolecarboxamide

CAS: 35261-06-4

Versatile small molecule scaffold

Formula: C₅H₇N₃O₂

Purity: Min. 95%

Molecular weight: 141.13 g/mol

Ref: 3D-KBA26106