CAS 35264-05-2

[(tert-butoxycarbonyl)amino](cyclohexyl)acetic acid

Description:

[(tert-butoxycarbonyl)amino](cyclohexyl)acetic acid, with the CAS number 35264-05-2, is an organic compound characterized by the presence of both an amino group and a carboxylic acid functional group, making it an amino acid derivative. The tert-butoxycarbonyl (Boc) group serves as a protective group for the amino functionality, which is commonly used in peptide synthesis to prevent unwanted reactions. The cyclohexyl group contributes to the compound's hydrophobic characteristics, influencing its solubility and interaction with biological systems. This compound typically appears as a white to off-white solid and is soluble in organic solvents, while its solubility in water may be limited due to the bulky Boc and cyclohexyl groups. Its structure allows for potential applications in medicinal chemistry, particularly in the development of peptide-based drugs. The presence of both the amino and carboxylic acid groups also suggests that it can participate in various chemical reactions, including coupling reactions and esterification, making it a versatile building block in organic synthesis.

Formula: C₁₃H₂₃NO₄

InChI: InChI=1/C13H23NO4/c1-13(2,3)18-12(17)14-10(11(15)16)9-7-5-4-6-8-9/h9-10H,4-8H2,1-3H3,(H,14,17)(H,15,16)

SMILES: CC(C)(C)OC(=NC(C1CCCCC1)C(=O)O)O

Synonyms:

• [(tert-Butoxycarbonyl)amino](cyclohexyl)acetic acid

N-tert-Butoxycarbonyl-DL-cyclohexylglycine

CAS: 35264-05-2

Formula: C₁₃H₂₃NO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 257.3260

Ref: IN-DA0039MC

Boc-2-Cyclohexylglycine

CAS: 35264-05-2

Boc-2-Cyclohexylglycine

Purity: 97%

Molecular weight: 257.33g/mol

Ref: 54-OR939277

N-Boc-2-Cyclohexyl-DL-glycine

CAS: 35264-05-2

Formula: C₁₃H₂₃NO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 257.33

Ref: 10-F034347