CAS 35264-46-1
:[(8beta)-10-methoxy-6-methylergolin-8-yl]methyl 5-bromopyridine-3-carboxylate
Description:
The chemical substance known as [(8beta)-10-methoxy-6-methylergolin-8-yl]methyl 5-bromopyridine-3-carboxylate, with the CAS number 35264-46-1, is a complex organic compound that belongs to the class of ergoline derivatives. Ergoline compounds are known for their diverse biological activities, including effects on the central nervous system. This particular compound features a methoxy group and a methyl group on the ergoline structure, which may influence its pharmacological properties. The presence of a bromine atom in the pyridine ring suggests potential reactivity and may enhance its biological activity. The carboxylate functional group indicates that this compound could participate in various chemical reactions, such as esterification or nucleophilic substitution. Overall, the unique structural features of this compound may contribute to its potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, detailed studies would be necessary to fully elucidate its properties and biological effects.
Formula:C23H24BrN3O3
InChI:InChI=1/C23H24BrN3O3/c1-27-12-14(13-30-22(28)16-6-17(24)11-25-9-16)8-23(29-2)18-4-3-5-19-21(18)15(10-26-19)7-20(23)27/h3-6,9-11,14,20,26H,7-8,12-13H2,1-2H3/t14-,20-,23+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
N1-Nornicergoline
CAS:Controlled Product<p>Impurity Nicergoline EP Impurity B<br>Applications N1-Nornicergoline is an impurity of Nicergoline (N394550). Nicergoline is a drug used for age-dependent cognitive impairment and it protects cultured neurons against β-amyloid toxicity.<br>References Mizuno, T., et. al.: Brain Res., 1066, 78 (2005)<br></p>Formula:C23H24BrN3O3Color and Shape:White To BeigeMolecular weight:470.36N1-Nornicergoline-d3
CAS:Controlled ProductFormula:C24H23D3BrN3O4Color and Shape:NeatMolecular weight:503.4Nicergoline EP Impurity B
CAS:<p>Nicergoline EP Impurity B is a metabolite of nicergoline, a drug product. It has been synthesized for use as an impurity standard for analytical and pharmacopoeia purposes. Nicergoline EP Impurity B is not found in nature and has been shown to be metabolically stable in vitro. It can be used as a reference substance for the determination of nicergoline concentrations in human plasma samples.</p>Purity:Min. 95%



