CAS 35265-04-4
:2-[(1-Methylpropyl)amino]ethanol
Description:
2-[(1-Methylpropyl)amino]ethanol, also known as isobutylaminoethanol, is an organic compound characterized by its amino alcohol structure. It features a primary amine group and a hydroxyl group, which contribute to its reactivity and solubility properties. The presence of the isobutyl group enhances its hydrophobic characteristics while still allowing for hydrogen bonding due to the hydroxyl group. This compound is typically a colorless to pale yellow liquid with a characteristic amine odor. It is soluble in water and organic solvents, making it versatile for various applications, including as a surfactant, solvent, or intermediate in chemical synthesis. The compound's amine functionality can participate in various chemical reactions, such as alkylation and acylation, and it may exhibit biological activity, which warrants careful handling due to potential toxicity. Safety data sheets should be consulted for proper handling and storage guidelines, as with any chemical substance.
Formula:C6H15NO
InChI:InChI=1S/C6H15NO/c1-3-6(2)7-4-5-8/h6-8H,3-5H2,1-2H3
InChI key:InChIKey=YTVUVYDVQNALCM-UHFFFAOYSA-N
SMILES:C(NCCO)(CC)C
Synonyms:- 2-(2-Butylamino)ethanol
- 2-(Butan-2-Ylamino)Ethanol
- 2-[(Butan-2-yl)amino]ethan-1-ol
- Alpamine N 41
- Ethanol, 2-(sec-butylamino)-
- Ethanol, 2-[(1-methylpropyl)amino]-
- N-(2-Hydroxyethyl)-N-(butan-2-yl)amine
- NSC 128123
- sec-Butylmonoethanolamine
- 2-((1-Methylpropyl)amino)ethanol
- 2-[(1-Methylpropyl)amino]ethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-(2-Butylamino)ethanol
CAS:Stability Volatile
Applications 2-(2-Butylamino)ethanol is an intermediate used to prepare 2-arylimino-1,3-thiazolidines as progesterone receptor binding ligands.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Dixon, B., et al.: U.S., US 6353006 B1 20020305 (2002)Formula:C6H15NOColor and Shape:NeatMolecular weight:117.192-(2-Butylamino)ethanol-d4
CAS:Controlled ProductApplications 2-(2-Butylamino)ethanol-d4 is labelled 2-(2-Butylamino)ethanol (B693945) which is an intermediate used to prepare 2-arylimino-1,3-thiazolidines as progesterone receptor binding ligands.
References Dixon, B., et al.: U.S., US 6353006 B1 20020305 (2002)Formula:C6D4H11NOColor and Shape:NeatMolecular weight:121.214
