CAS 35265-82-8

2,4-dichloro-6-methylthieno[3,2-d]pyrimidine

Description:

2,4-Dichloro-6-methylthieno[3,2-d]pyrimidine is a heterocyclic compound characterized by its fused thieno and pyrimidine rings, which contribute to its unique chemical properties. This compound features two chlorine atoms at the 2 and 4 positions and a methyl group at the 6 position of the pyrimidine ring. It is typically a solid at room temperature and exhibits moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic nature. The presence of chlorine atoms enhances its reactivity, making it a useful intermediate in the synthesis of various pharmaceuticals and agrochemicals. Additionally, the thieno-pyrimidine structure is known for its biological activity, often exhibiting antimicrobial or anti-inflammatory properties. The compound's molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as halogenated compounds can pose environmental and health risks.

Formula: C₇H₄Cl₂N₂S

InChI: InChI=1S/C7H4Cl2N2S/c1-3-2-4-5(12-3)6(8)11-7(9)10-4/h2H,1H3

SMILES: Cc1cc2c(c(Cl)nc(Cl)n2)s1

Synonyms:

• Thieno[3,2-d]pyrimidine, 2,4-dichloro-6-methyl-

2,4-Dichloro-6-methylthieno[3,2-d]pyrimidine

CAS: 35265-82-8

Formula: C₇H₄Cl₂N₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 219.0911

Ref: IN-DA007DXS

2,4-Dichloro-6-methylthieno[3,2-d]pyrimidine

CAS: 35265-82-8

2,4-Dichloro-6-methylthieno[3,2-d]pyrimidine

Purity: 99%

Molecular weight: 219.10g/mol

Ref: 54-OR74178

2,4-Dichloro-6-methylthieno[3,2-d]pyrimidine

CAS: 35265-82-8

Formula: C₇H₄Cl₂N₂S

Purity: 98%

Color and Shape: Liquid, No data available.

Molecular weight: 219.08

Ref: 10-F231376

2,4-dichloro-6-methylthieno[3,2-d]pyrimidine

CAS: 35265-82-8

Versatile small molecule scaffold

Formula: C₇H₄Cl₂N₂S

Purity: Min. 95%

Molecular weight: 219.1 g/mol

Ref: 3D-KBA26582