CAS 35266-48-9
:N-(2-aminophenyl)-N~2~,N~2~-dimethylglycinamide
Description:
N-(2-aminophenyl)-N',N'-dimethylglycinamide, identified by CAS number 35266-48-9, is a chemical compound characterized by its amine and amide functional groups. This substance features a dimethylglycinamide backbone, which is modified by the presence of a 2-aminophenyl group. The structure suggests that it may exhibit properties typical of both amines and amides, including potential hydrogen bonding capabilities due to the presence of nitrogen atoms. The compound is likely to be soluble in polar solvents, given the presence of the amino group, which can engage in hydrogen bonding with solvent molecules. Its biological activity may be of interest in medicinal chemistry, particularly in the context of drug design, due to the presence of the aromatic amine, which can influence pharmacological properties. Additionally, the dimethyl substitution may affect its steric and electronic properties, potentially impacting its reactivity and interaction with biological targets. Overall, this compound represents a unique structure that could have various applications in research and development within the fields of chemistry and pharmacology.
Formula:C10H15N3O
InChI:InChI=1/C10H15N3O/c1-13(2)7-10(14)12-9-6-4-3-5-8(9)11/h3-6H,7,11H2,1-2H3,(H,12,14)
SMILES:CN(C)CC(=Nc1ccccc1N)O
Synonyms:- acetamide, N-(2-aminophenyl)-2-(dimethylamino)-
- UKRORGSYN-BB BBV-023314
- N~1~-(2-aminophenyl)-N~2~,N~2~-dimethylglycinamide(SALTDATA: FREE)
- N1-(2-AMINOPHENYL)-N2,N2-DIMETHYLGLYCINAMIDE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N1-(2-Aminophenyl)-N2,N2-dimethylglycinamide
CAS:Controlled ProductApplications N1-(2-Aminophenyl)-N2,N2-dimethylglycinamide (cas# 35266-48-9) is a useful research chemical.
Formula:C10H15N3OColor and Shape:NeatMolecular weight:193.25
