CAS 35266-64-9

2-(4-benzyloxy-3-methoxy-phenyl)-N-methyl-ethanamine hydrochloride

Description:

2-(4-Benzyloxy-3-methoxy-phenyl)-N-methyl-ethanamine hydrochloride, with the CAS number 35266-64-9, is a chemical compound that belongs to the class of substituted phenethylamines. This substance features a complex structure characterized by a phenyl ring substituted with both a benzyloxy and a methoxy group, which contribute to its unique chemical properties. The presence of the N-methyl group indicates that it is a tertiary amine, which can influence its solubility and reactivity. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, making it easier to handle in laboratory settings. The compound may exhibit biological activity, potentially interacting with neurotransmitter systems, although specific pharmacological effects would require further investigation. Its synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as recrystallization or chromatography. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₇H₂₂ClNO₂

InChI: InChI=1/C17H21NO2.ClH/c1-18-11-10-14-8-9-16(17(12-14)19-2)20-13-15-6-4-3-5-7-15;/h3-9,12,18H,10-11,13H2,1-2H3;1H

SMILES: CNCCc1ccc(c(c1)OC)OCc1ccccc1.Cl

Synonyms:

• 4-Benzyloxy-3-methoxy-N-methylphenethylamine Hydrochloride
• 3-Methoxy-N-methyl-4-(phenylmethoxy)benzeneethanamine Hydrochloride
• N-Methy-4-benzyloxy-3-methoxyphenethylamine Hydrochloride

4-Benzyloxy-3-methoxy-N-methylphenethylamine hydrochloride

Controlled Product

CAS: 35266-64-9

Please enquire for more information about 4-Benzyloxy-3-methoxy-N-methylphenethylamine hydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₇H₂₂ClNO₂

Purity: Min. 95%

Molecular weight: 307.81 g/mol

Ref: 3D-FB18461