CAS 352707-76-7
:(1R,2S)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}cyclopentanecarboxylic acid
Description:
The chemical substance known as (1R,2S)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}cyclopentanecarboxylic acid, with the CAS number 352707-76-7, is a synthetic compound that features a cyclopentanecarboxylic acid core. This compound is characterized by the presence of a fluorenylmethoxycarbonyl (Fmoc) protecting group, which is commonly used in peptide synthesis to protect amino groups. The stereochemistry indicated by (1R,2S) suggests specific spatial arrangements of atoms, which can influence the compound's reactivity and interactions. The presence of both an amino group and a carboxylic acid group makes it an amino acid derivative, potentially useful in the synthesis of peptides or other bioactive molecules. Its unique structure may impart specific biological activities or properties, making it of interest in medicinal chemistry and drug development. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature, which are important considerations in its application.
Formula:C21H21NO4
InChI:InChI=1/C21H21NO4/c23-20(24)17-10-5-11-19(17)22-21(25)26-12-18-15-8-3-1-6-13(15)14-7-2-4-9-16(14)18/h1-4,6-9,17-19H,5,10-12H2,(H,22,25)(H,23,24)/t17-,19+/m1/s1
Synonyms:- cis-2-Aminocyclopentanecarboxylic acid, N-FMOC protected
- CIS-2-(9-FLUORENYLMETHOXYCARBONYLAMINO)CYCLOPENTANECARBOXYLIC ACID
- CIS-2-((((9H-FLUOREN-9-YL)METHOXY)CARBONYL)AMINO)CYCLOPENTANECARBOXYLIC ACID
- Cis-(1S,2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclopentane-1-carboxylic acid
- rel-(1S,2R)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)cyclopentane-1-carboxylic acid
- Fmoc-NH-cis-cyclopentane-COOH
- Cyclopentanecarboxylic acid, 2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-, (1R,2S)-rel-
- Cis-2-((((9H-Fluoren-9-Yl)Methoxy)Carbonyl)Amino)Cyclopentanecarboxylic Acid(WXC04337)
- cis-2-AMinocyclopentanecarboxylic acid, N-
- (1R,2S)-rel-2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]cyclopentanecarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Cis-Fmoc-2-Amino-1-cyclopentanecarboxylic acid
CAS:Formula:C21H21NO4Purity:95%Color and Shape:SolidMolecular weight:351.3957cis-2-Aminocyclopentanecarboxylic acid, N-FMOC protected
CAS:cis-2-Aminocyclopentanecarboxylic acid, N-FMOC protectedPurity:96%Color and Shape:PowderMolecular weight:351.40g/mol(+/-)-Fmoc-cis-2-aminocyclopentane carboxylic acid
CAS:Fmoc-cis-(1R,2S)-2-aminocyclopentane carboxylic acid is a versatile building block that is used in the synthesis of many important compounds. It can be used as a scaffold for organic synthesis and can be converted to an intermediate for peptides and proteins. Fmoc-cis-(1R,2S)-2-aminocyclopentane carboxylic acid is also useful in chemical reactions due to its high reactivity, including reactions with thiols, amines, alcohols, and others. This compound has been shown to form complexes with metals such as palladium or platinum.
Formula:C21H21NO4Purity:Min. 96 Area-%Color and Shape:White PowderMolecular weight:351.4 g/mol(+/-)-Fmoc-cis-2-aminocyclopentane carboxylic acid
CAS:Formula:C21H21NO4Purity:98.0%Color and Shape:SolidMolecular weight:351.402



