CAS 35271-74-0
:3-(4-Chlorophenyl)pentanedioic acid
Description:
3-(4-Chlorophenyl)pentanedioic acid, also known by its CAS number 35271-74-0, is an organic compound characterized by its structure, which includes a pentanedioic acid backbone with a 4-chlorophenyl group attached to the third carbon. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. It features two carboxylic acid functional groups, which contribute to its acidic properties and potential reactivity in various chemical reactions, such as esterification or amidation. The presence of the chlorophenyl group can influence its biological activity and interactions, making it of interest in medicinal chemistry and material science. Additionally, the compound may exhibit properties such as moderate melting and boiling points, depending on its purity and crystalline form. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or environmental impact.
Formula:C11H11ClO4
InChI:InChI=1/C11H11ClO4/c12-9-3-1-7(2-4-9)8(5-10(13)14)6-11(15)16/h1-4,8H,5-6H2,(H,13,14)(H,15,16)/p-2
InChI key:InChIKey=URXVLIVRJJNJII-UHFFFAOYSA-N
SMILES:C(CC(O)=O)(CC(O)=O)C1=CC=C(Cl)C=C1
Synonyms:- 3-(4-Chlorophenyl)Pentanedioate
- 3-(4-Chlorophenyl)Pentanedioic Acid
- Glutaric acid, 3-(p-chlorophenyl)-
- Pentanedioic acid, 3-(4-chlorophenyl)-
- β-(4-chlorophenyl)Glutaric acid
- β-(p-Chlorophenyl)glutaric acid
- 3-(4-Chlorophenyl)glutaric acid
- 3-(4-chlorophenyl glutaric acid)
- -(p-Chlorophenyl)glutaric Acid
- 3-(4-chlorophenyl) glutarate
- -(4-Chlorophenyl)glutaricacid
- CBI-BB ZERO/006271
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
3-(4-Chlorophenyl)pentanedioic acid
CAS:Formula:C11H11ClO4Purity:97%Color and Shape:SolidMolecular weight:242.6556Baclofen Impurity 1
CAS:Formula:C11H11ClO4Color and Shape:White To Off-White SolidMolecular weight:242.663-(4-Chlorophenyl)glutaric Acid
CAS:Controlled ProductFormula:C11H11ClO4Color and Shape:NeatMolecular weight:242.663-(4-Chlorophenyl)pentanedioic acid
CAS:3-(4-Chlorophenyl)pentanedioic acidFormula:C11H11ClO4Purity:97%Color and Shape: white solidMolecular weight:242.66g/mol3-(4-Chlorophenyl)glutaric Acid
CAS:<p>Applications 3-(4-Chlorophenyl)glutaric Acid (cas# 35271-74-0) is a compound useful in organic synthesis. Baclofen Impurity 1<br></p>Formula:C11H11ClO4Color and Shape:NeatMolecular weight:242.663-(4-Chlorophenyl)pentanedioic acid
CAS:Formula:C11H11ClO4Purity:97%Color and Shape:Liquid, No data available.Molecular weight:242.663-(4-Chlorophenyl)glutaric acid
CAS:<p>3-(4-Chlorophenyl)glutaric acid is a subunit of lanthanide complexes. It has been synthesized from cinchona alkaloids and single-crystal x-ray diffraction data obtained in the absence of ligands. 3-(4-Chlorophenyl)glutaric acid is a desymmetrization reagent and has been shown to be an effective ligand for lanthanide complexes. This compound has the potential to form impurities during the synthesis process, which can lead to morphological changes, luminescence, or high-performance liquid chromatography interference.</p>Formula:C11H11ClO4Purity:Min. 95%Molecular weight:242.66 g/mol







