CymitQuimica logo

CAS 35272-15-2

:

2-methyl-1,3-thiazole-4-carboxylic acid

Description:
2-Methyl-1,3-thiazole-4-carboxylic acid is a heterocyclic organic compound characterized by a thiazole ring, which contains both sulfur and nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the methyl group at the second position of the thiazole ring influences its reactivity and solubility. Typically, compounds like this exhibit moderate to high polarity due to the carboxylic acid group, making them soluble in polar solvents such as water and alcohols. The thiazole ring structure often imparts biological activity, making derivatives of this compound of interest in pharmaceutical research. Additionally, 2-methyl-1,3-thiazole-4-carboxylic acid may participate in various chemical reactions, including esterification and amidation, due to its functional groups. Its applications can extend to agrochemicals, pharmaceuticals, and as a building block in organic synthesis. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C5H5NO2S
InChI:InChI=1/C5H5NO2S/c1-3-6-4(2-9-3)5(7)8/h2H,1H3,(H,7,8)
InChI key:ZHDRDZMTEOIWSX-UHFFFAOYSA-N
SMILES:Cc1nc(cs1)C(=O)O
Synonyms:
  • 2-Methyl-thiazole-4-carboxylic acid
Found 5 products.