CAS 35274-18-1

N-(4-chlorophenyl)propanethioamide

Description:

N-(4-chlorophenyl)propanethioamide, with the CAS number 35274-18-1, is an organic compound characterized by the presence of a thioamide functional group. This compound features a propanethioamide backbone, where a 4-chlorophenyl group is attached to the nitrogen atom of the thioamide. The presence of the chlorine atom on the phenyl ring contributes to its chemical reactivity and potential biological activity. Typically, thioamides exhibit properties similar to amides but with distinct differences due to the sulfur atom, which can influence their solubility, stability, and reactivity. This compound may be of interest in various fields, including medicinal chemistry and agrochemicals, due to its potential applications in drug development or as a synthetic intermediate. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the chlorine substituent, which may impart toxicity or environmental concerns.

Formula: C₉H₁₀ClNS

InChI: InChI=1/C9H10ClNS/c1-2-9(12)11-8-5-3-7(10)4-6-8/h3-6H,2H2,1H3,(H,11,12)

SMILES: CCC(=S)Nc1ccc(cc1)Cl