CAS 35288-44-9
:4-Propoxy-3-nitrobenzoic acid
Description:
4-Propoxy-3-nitrobenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with a propoxy group and a nitro group. The presence of the propoxy group enhances its solubility in organic solvents, while the nitro group introduces significant polarity and potential for hydrogen bonding. This compound typically appears as a solid at room temperature and is often used in various chemical syntheses and research applications due to its functional groups, which can participate in electrophilic aromatic substitution reactions. The nitro group also contributes to the compound's reactivity, making it a useful intermediate in the synthesis of other chemical entities. Additionally, the compound's properties, such as melting point, boiling point, and solubility, can vary based on the purity and specific conditions under which it is handled. Safety precautions should be taken when working with this substance, as nitro compounds can be hazardous. Overall, 4-Propoxy-3-nitrobenzoic acid is a versatile compound with applications in organic chemistry and materials science.
Formula:C10H11NO5
InChI:InChI=1/C10H11NO5/c1-2-5-16-9-4-3-7(10(12)13)6-8(9)11(14)15/h3-4,6H,2,5H2,1H3,(H,12,13)
SMILES:CCCOc1ccc(cc1N(=O)=O)C(=O)O
Synonyms:- 3-Nitro-4-Propoxybenzoic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
